C26H36N7O8S- — CID 172989548
2-[2-ethoxy-5-[4-[3-[hydroxy(oxido)amino]oxypropyl]piperazin-1-yl]sulfonylphenyl]-6-[(E)-hydroxyiminomethyl]-5-methyl-7-propyl-3H-pyrrolo[2,1-f][1,2,4]triazin-4-one (PubChem CID 172989548) has the molecular formula C26H36N7O8S- and a molecular weight of 606.68 g/mol. Its IUPAC name is 2-[2-ethoxy-5-[4-[3-[hydroxy(oxido)amino]oxypropyl]piperazin-1-yl]sulfonylphenyl]-6-[(E)-hydroxyiminomethyl]-5-methyl-7-propyl-3H-pyrrolo[2,1-f][1,2,4]triazin-4-one.
| Compound Name | 2-[2-ethoxy-5-[4-[3-[hydroxy(oxido)amino]oxypropyl]piperazin-1-yl]sulfonylphenyl]-6-[(E)-hydroxyiminomethyl]-5-methyl-7-propyl-3H-pyrrolo[2,1-f][1,2,4]triazin-4-one |
|---|---|
| PubChem CID | 172989548 |
| Molecular Formula | C26H36N7O8S- |
| Molecular Weight | 606.68 g/mol |
| Exact Mass | 606.24 |
| IUPAC Name | 2-[2-ethoxy-5-[4-[3-[hydroxy(oxido)amino]oxypropyl]piperazin-1-yl]sulfonylphenyl]-6-[(E)-hydroxyiminomethyl]-5-methyl-7-propyl-3H-pyrrolo[2,1-f][1,2,4]triazin-4-one |
| SMILES | CCCc1c(/C=N/O)c(C)c2c(=O)[nH]c(-c3cc(S(=O)(=O)N4CCN(CCCON([O-])O)CC4)ccc3OCC)nn12 |
| InChI | InChI=1S/C26H36N7O8S/c1-4-7-22-21(17-27-35)18(3)24-26(34)28-25(29-32(22)24)20-16-19(8-9-23(20)40-5-2)42(38,39)31-13-11-30(12-14-31)10-6-15-41-33(36)37/h8-9,16-17,35-36H,4-7,10-15H2,1-3H3,(H,28,29,34)/q-1/b27-17+ |
| InChIKey | UVBOUYPNTFPJSA-WPWMEQJKSA-N |
| XLogP | 1.97 |
| TPSA | 188.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.68 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|