C26H35N7O6S — CID 145311508
2-[4-[4-ethoxy-3-[5-ethyl-6-[(E)-hydroxyiminomethyl]-4-oxo-7-propyl-3H-pyrrolo[2,1-f][1,2,4]triazin-2-yl]phenyl]sulfanylpiperazin-1-yl]ethyl nitrate (PubChem CID 145311508) has the molecular formula C26H35N7O6S and a molecular weight of 573.68 g/mol. Its IUPAC name is 2-[4-[4-ethoxy-3-[5-ethyl-6-[(E)-hydroxyiminomethyl]-4-oxo-7-propyl-3H-pyrrolo[2,1-f][1,2,4]triazin-2-yl]phenyl]sulfanylpiperazin-1-yl]ethyl nitrate.
| Compound Name | 2-[4-[4-ethoxy-3-[5-ethyl-6-[(E)-hydroxyiminomethyl]-4-oxo-7-propyl-3H-pyrrolo[2,1-f][1,2,4]triazin-2-yl]phenyl]sulfanylpiperazin-1-yl]ethyl nitrate |
|---|---|
| PubChem CID | 145311508 |
| Molecular Formula | C26H35N7O6S |
| Molecular Weight | 573.68 g/mol |
| Exact Mass | 573.24 |
| IUPAC Name | 2-[4-[4-ethoxy-3-[5-ethyl-6-[(E)-hydroxyiminomethyl]-4-oxo-7-propyl-3H-pyrrolo[2,1-f][1,2,4]triazin-2-yl]phenyl]sulfanylpiperazin-1-yl]ethyl nitrate |
| SMILES | CCCc1c(/C=N/O)c(CC)c2c(=O)[nH]c(-c3cc(SN4CCN(CCO[N+](=O)[O-])CC4)ccc3OCC)nn12 |
| InChI | InChI=1S/C26H35N7O6S/c1-4-7-22-21(17-27-35)19(5-2)24-26(34)28-25(29-32(22)24)20-16-18(8-9-23(20)38-6-3)40-31-12-10-30(11-13-31)14-15-39-33(36)37/h8-9,16-17,35H,4-7,10-15H2,1-3H3,(H,28,29,34)/b27-17+ |
| InChIKey | RGGBAFDNJQLGRT-WPWMEQJKSA-N |
| XLogP | 3.24 |
| TPSA | 150.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.68 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|