C22H28N6O7S — CID 167430569
2-[3-[4-ethoxy-3-(5-methyl-4-oxo-7-propyl-3H-imidazo[5,1-f][1,2,4]triazin-2-yl)phenyl]sulfonylazetidin-1-yl]ethyl nitrate (PubChem CID 167430569) has the molecular formula C22H28N6O7S and a molecular weight of 520.57 g/mol. Its IUPAC name is 2-[3-[4-ethoxy-3-(5-methyl-4-oxo-7-propyl-3H-imidazo[5,1-f][1,2,4]triazin-2-yl)phenyl]sulfonylazetidin-1-yl]ethyl nitrate.
| Compound Name | 2-[3-[4-ethoxy-3-(5-methyl-4-oxo-7-propyl-3H-imidazo[5,1-f][1,2,4]triazin-2-yl)phenyl]sulfonylazetidin-1-yl]ethyl nitrate |
|---|---|
| PubChem CID | 167430569 |
| Molecular Formula | C22H28N6O7S |
| Molecular Weight | 520.57 g/mol |
| Exact Mass | 520.17 |
| IUPAC Name | 2-[3-[4-ethoxy-3-(5-methyl-4-oxo-7-propyl-3H-imidazo[5,1-f][1,2,4]triazin-2-yl)phenyl]sulfonylazetidin-1-yl]ethyl nitrate |
| SMILES | CCCc1nc(C)c2c(=O)[nH]c(-c3cc(S(=O)(=O)C4CN(CCO[N+](=O)[O-])C4)ccc3OCC)nn12 |
| InChI | InChI=1S/C22H28N6O7S/c1-4-6-19-23-14(3)20-22(29)24-21(25-27(19)20)17-11-15(7-8-18(17)34-5-2)36(32,33)16-12-26(13-16)9-10-35-28(30)31/h7-8,11,16H,4-6,9-10,12-13H2,1-3H3,(H,24,25,29) |
| InChIKey | HZLJBUYFDQGOAH-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 162.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.57 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|