C25H34N6O8S — CID 162711255
[1-[1-[4-ethoxy-3-(5-methyl-4-oxo-7-propyl-3H-imidazo[5,1-f][1,2,4]triazin-2-yl)phenyl]sulfonylpiperidin-4-yl]-3-hydroxypropan-2-yl] nitrate (PubChem CID 162711255) has the molecular formula C25H34N6O8S and a molecular weight of 578.65 g/mol. Its IUPAC name is [1-[1-[4-ethoxy-3-(5-methyl-4-oxo-7-propyl-3H-imidazo[5,1-f][1,2,4]triazin-2-yl)phenyl]sulfonylpiperidin-4-yl]-3-hydroxypropan-2-yl] nitrate.
| Compound Name | [1-[1-[4-ethoxy-3-(5-methyl-4-oxo-7-propyl-3H-imidazo[5,1-f][1,2,4]triazin-2-yl)phenyl]sulfonylpiperidin-4-yl]-3-hydroxypropan-2-yl] nitrate |
|---|---|
| PubChem CID | 162711255 |
| Molecular Formula | C25H34N6O8S |
| Molecular Weight | 578.65 g/mol |
| Exact Mass | 578.22 |
| IUPAC Name | [1-[1-[4-ethoxy-3-(5-methyl-4-oxo-7-propyl-3H-imidazo[5,1-f][1,2,4]triazin-2-yl)phenyl]sulfonylpiperidin-4-yl]-3-hydroxypropan-2-yl] nitrate |
| SMILES | CCCc1nc(C)c2c(=O)[nH]c(-c3cc(S(=O)(=O)N4CCC(CC(CO)O[N+](=O)[O-])CC4)ccc3OCC)nn12 |
| InChI | InChI=1S/C25H34N6O8S/c1-4-6-22-26-16(3)23-25(33)27-24(28-30(22)23)20-14-19(7-8-21(20)38-5-2)40(36,37)29-11-9-17(10-12-29)13-18(15-32)39-31(34)35/h7-8,14,17-18,32H,4-6,9-13,15H2,1-3H3,(H,27,28,33) |
| InChIKey | UZUMCHJDTRVRJF-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 182.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.65 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|