C30H46N5O7PS — CID 135769502
2-[5-[4-(diethoxyphosphorylmethyl)piperidin-1-yl]sulfonyl-2-ethoxyphenyl]-7-hexyl-5-methyl-3H-imidazo[5,1-f][1,2,4]triazin-4-one (PubChem CID 135769502) has the molecular formula C30H46N5O7PS and a molecular weight of 651.77 g/mol. Its IUPAC name is 2-[5-[4-(diethoxyphosphorylmethyl)piperidin-1-yl]sulfonyl-2-ethoxyphenyl]-7-hexyl-5-methyl-3H-imidazo[5,1-f][1,2,4]triazin-4-one.
| Compound Name | 2-[5-[4-(diethoxyphosphorylmethyl)piperidin-1-yl]sulfonyl-2-ethoxyphenyl]-7-hexyl-5-methyl-3H-imidazo[5,1-f][1,2,4]triazin-4-one |
|---|---|
| PubChem CID | 135769502 |
| Molecular Formula | C30H46N5O7PS |
| Molecular Weight | 651.77 g/mol |
| Exact Mass | 651.29 |
| IUPAC Name | 2-[5-[4-(diethoxyphosphorylmethyl)piperidin-1-yl]sulfonyl-2-ethoxyphenyl]-7-hexyl-5-methyl-3H-imidazo[5,1-f][1,2,4]triazin-4-one |
| SMILES | CCCCCCc1nc(C)c2c(=O)[nH]c(-c3cc(S(=O)(=O)N4CCC(CP(=O)(OCC)OCC)CC4)ccc3OCC)nn12 |
| InChI | InChI=1S/C30H46N5O7PS/c1-6-10-11-12-13-27-31-22(5)28-30(36)32-29(33-35(27)28)25-20-24(14-15-26(25)40-7-2)44(38,39)34-18-16-23(17-19-34)21-43(37,41-8-3)42-9-4/h14-15,20,23H,6-13,16-19,21H2,1-5H3,(H,32,33,36) |
| InChIKey | UCYFHLZEPLXLCO-UHFFFAOYSA-N |
| XLogP | 5.58 |
| TPSA | 145.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 651.77 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|