C29H37N7O4S — CID 135769448
2-[2-ethoxy-5-(4-pyridin-2-ylpiperazin-1-yl)sulfonylphenyl]-7-hexyl-5-methyl-3H-imidazo[5,1-f][1,2,4]triazin-4-one (PubChem CID 135769448) has the molecular formula C29H37N7O4S and a molecular weight of 579.73 g/mol. Its IUPAC name is 2-[2-ethoxy-5-(4-pyridin-2-ylpiperazin-1-yl)sulfonylphenyl]-7-hexyl-5-methyl-3H-imidazo[5,1-f][1,2,4]triazin-4-one.
| Compound Name | 2-[2-ethoxy-5-(4-pyridin-2-ylpiperazin-1-yl)sulfonylphenyl]-7-hexyl-5-methyl-3H-imidazo[5,1-f][1,2,4]triazin-4-one |
|---|---|
| PubChem CID | 135769448 |
| Molecular Formula | C29H37N7O4S |
| Molecular Weight | 579.73 g/mol |
| Exact Mass | 579.26 |
| IUPAC Name | 2-[2-ethoxy-5-(4-pyridin-2-ylpiperazin-1-yl)sulfonylphenyl]-7-hexyl-5-methyl-3H-imidazo[5,1-f][1,2,4]triazin-4-one |
| SMILES | CCCCCCc1nc(C)c2c(=O)[nH]c(-c3cc(S(=O)(=O)N4CCN(c5ccccn5)CC4)ccc3OCC)nn12 |
| InChI | InChI=1S/C29H37N7O4S/c1-4-6-7-8-12-26-31-21(3)27-29(37)32-28(33-36(26)27)23-20-22(13-14-24(23)40-5-2)41(38,39)35-18-16-34(17-19-35)25-11-9-10-15-30-25/h9-11,13-15,20H,4-8,12,16-19H2,1-3H3,(H,32,33,37) |
| InChIKey | UMYXAWYZHWEIIT-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 125.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.73 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|