C27H38N7O9S+ — CID 137198626
2-[4-[4-ethoxy-3-[6-[(E)-2-hydroxyethoxyiminomethyl]-5-methyl-4-oxo-7-propyl-3H-pyrrolo[2,1-f][1,2,4]triazin-2-yl]phenyl]sulfonylpiperazin-1-yl]ethoxy-hydroxy-oxoazanium (PubChem CID 137198626) has the molecular formula C27H38N7O9S+ and a molecular weight of 636.71 g/mol. Its IUPAC name is 2-[4-[4-ethoxy-3-[6-[(E)-2-hydroxyethoxyiminomethyl]-5-methyl-4-oxo-7-propyl-3H-pyrrolo[2,1-f][1,2,4]triazin-2-yl]phenyl]sulfonylpiperazin-1-yl]ethoxy-hydroxy-oxoazanium.
| Compound Name | 2-[4-[4-ethoxy-3-[6-[(E)-2-hydroxyethoxyiminomethyl]-5-methyl-4-oxo-7-propyl-3H-pyrrolo[2,1-f][1,2,4]triazin-2-yl]phenyl]sulfonylpiperazin-1-yl]ethoxy-hydroxy-oxoazanium |
|---|---|
| PubChem CID | 137198626 |
| Molecular Formula | C27H38N7O9S+ |
| Molecular Weight | 636.71 g/mol |
| Exact Mass | 636.24 |
| IUPAC Name | 2-[4-[4-ethoxy-3-[6-[(E)-2-hydroxyethoxyiminomethyl]-5-methyl-4-oxo-7-propyl-3H-pyrrolo[2,1-f][1,2,4]triazin-2-yl]phenyl]sulfonylpiperazin-1-yl]ethoxy-hydroxy-oxoazanium |
| SMILES | CCCc1c(/C=N/OCCO)c(C)c2c(=O)[nH]c(-c3cc(S(=O)(=O)N4CCN(CCO[N+](=O)O)CC4)ccc3OCC)nn12 |
| InChI | InChI=1S/C27H37N7O9S/c1-4-6-23-22(18-28-42-16-14-35)19(3)25-27(36)29-26(30-33(23)25)21-17-20(7-8-24(21)41-5-2)44(39,40)32-11-9-31(10-12-32)13-15-43-34(37)38/h7-8,17-18,35H,4-6,9-16H2,1-3H3,(H-,29,30,36,37,38)/p+1/b28-18+ |
| InChIKey | BLXHSNKJNXYBLK-MTDXEUNCSA-O |
| XLogP | 1.10 |
| TPSA | 191.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 636.71 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|