C25H34N7O8S+ — CID 137198611
2-[4-[4-ethoxy-3-[6-[(E)-hydroxyiminomethyl]-5-methyl-4-oxo-7-propyl-3H-pyrrolo[2,1-f][1,2,4]triazin-2-yl]phenyl]sulfonylpiperazin-1-yl]ethoxy-hydroxy-oxoazanium (PubChem CID 137198611) has the molecular formula C25H34N7O8S+ and a molecular weight of 592.66 g/mol. Its IUPAC name is 2-[4-[4-ethoxy-3-[6-[(E)-hydroxyiminomethyl]-5-methyl-4-oxo-7-propyl-3H-pyrrolo[2,1-f][1,2,4]triazin-2-yl]phenyl]sulfonylpiperazin-1-yl]ethoxy-hydroxy-oxoazanium.
| Compound Name | 2-[4-[4-ethoxy-3-[6-[(E)-hydroxyiminomethyl]-5-methyl-4-oxo-7-propyl-3H-pyrrolo[2,1-f][1,2,4]triazin-2-yl]phenyl]sulfonylpiperazin-1-yl]ethoxy-hydroxy-oxoazanium |
|---|---|
| PubChem CID | 137198611 |
| Molecular Formula | C25H34N7O8S+ |
| Molecular Weight | 592.66 g/mol |
| Exact Mass | 592.22 |
| IUPAC Name | 2-[4-[4-ethoxy-3-[6-[(E)-hydroxyiminomethyl]-5-methyl-4-oxo-7-propyl-3H-pyrrolo[2,1-f][1,2,4]triazin-2-yl]phenyl]sulfonylpiperazin-1-yl]ethoxy-hydroxy-oxoazanium |
| SMILES | CCCc1c(/C=N/O)c(C)c2c(=O)[nH]c(-c3cc(S(=O)(=O)N4CCN(CCO[N+](=O)O)CC4)ccc3OCC)nn12 |
| InChI | InChI=1S/C25H33N7O8S/c1-4-6-21-20(16-26-34)17(3)23-25(33)27-24(28-31(21)23)19-15-18(7-8-22(19)39-5-2)41(37,38)30-11-9-29(10-12-30)13-14-40-32(35)36/h7-8,15-16H,4-6,9-14H2,1-3H3,(H2-,27,28,33,34,35,36)/p+1/b26-16+ |
| InChIKey | SJVBTXCOKBTNSA-WGOQTCKBSA-O |
| XLogP | 1.56 |
| TPSA | 182.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.66 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|