C24H22ClF3N4O4 — CID 142478064
3-[(Z)-amino-(3-methyliminomorpholin-2-ylidene)methoxy]-4-chloro-N-[3-(3-hydroxybut-1-ynyl)-5-(trifluoromethyl)phenyl]benzamide (PubChem CID 142478064) has the molecular formula C24H22ClF3N4O4 and a molecular weight of 522.91 g/mol. Its IUPAC name is 3-[(Z)-amino-(3-methyliminomorpholin-2-ylidene)methoxy]-4-chloro-N-[3-(3-hydroxybut-1-ynyl)-5-(trifluoromethyl)phenyl]benzamide.
| Compound Name | 3-[(Z)-amino-(3-methyliminomorpholin-2-ylidene)methoxy]-4-chloro-N-[3-(3-hydroxybut-1-ynyl)-5-(trifluoromethyl)phenyl]benzamide |
|---|---|
| PubChem CID | 142478064 |
| Molecular Formula | C24H22ClF3N4O4 |
| Molecular Weight | 522.91 g/mol |
| Exact Mass | 522.13 |
| IUPAC Name | 3-[(Z)-amino-(3-methyliminomorpholin-2-ylidene)methoxy]-4-chloro-N-[3-(3-hydroxybut-1-ynyl)-5-(trifluoromethyl)phenyl]benzamide |
| SMILES | C/N=C1\NCCO\C1=C(\N)Oc1cc(C(=O)Nc2cc(C#CC(C)O)cc(C(F)(F)F)c2)ccc1Cl |
| InChI | InChI=1S/C24H22ClF3N4O4/c1-13(33)3-4-14-9-16(24(26,27)28)12-17(10-14)32-23(34)15-5-6-18(25)19(11-15)36-21(29)20-22(30-2)31-7-8-35-20/h5-6,9-13,33H,7-8,29H2,1-2H3,(H,30,31)(H,32,34)/b21-20- |
| InChIKey | LLISLKCEIUJCDT-MRCUWXFGSA-N |
| XLogP | 3.50 |
| TPSA | 118.20 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.91 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|