C21H23F3N6O2 — CID 142478417
6-amino-1-methyl-4-[1-[5-[2-(trifluoromethyl)morpholin-4-yl]pyrimidin-2-yl]ethylamino]quinolin-2-one (PubChem CID 142478417) has the molecular formula C21H23F3N6O2 and a molecular weight of 448.45 g/mol. Its IUPAC name is 6-amino-1-methyl-4-[1-[5-[2-(trifluoromethyl)morpholin-4-yl]pyrimidin-2-yl]ethylamino]quinolin-2-one.
| Compound Name | 6-amino-1-methyl-4-[1-[5-[2-(trifluoromethyl)morpholin-4-yl]pyrimidin-2-yl]ethylamino]quinolin-2-one |
|---|---|
| PubChem CID | 142478417 |
| Molecular Formula | C21H23F3N6O2 |
| Molecular Weight | 448.45 g/mol |
| Exact Mass | 448.18 |
| IUPAC Name | 6-amino-1-methyl-4-[1-[5-[2-(trifluoromethyl)morpholin-4-yl]pyrimidin-2-yl]ethylamino]quinolin-2-one |
| SMILES | CC(Nc1cc(=O)n(C)c2ccc(N)cc12)c1ncc(N2CCOC(C(F)(F)F)C2)cn1 |
| InChI | InChI=1S/C21H23F3N6O2/c1-12(28-16-8-19(31)29(2)17-4-3-13(25)7-15(16)17)20-26-9-14(10-27-20)30-5-6-32-18(11-30)21(22,23)24/h3-4,7-10,12,18,28H,5-6,11,25H2,1-2H3 |
| InChIKey | GCMCZESGMGRYMW-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 98.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.45 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|