C20H26ClN5O2 — CID 142478603
5-[(3-amino-2-chloro-4-pyridinyl)amino]-3-(3-hydroxy-3,4-dimethylpentyl)-1-methylbenzimidazol-2-one (PubChem CID 142478603) has the molecular formula C20H26ClN5O2 and a molecular weight of 403.91 g/mol. Its IUPAC name is 5-[(3-amino-2-chloro-4-pyridinyl)amino]-3-(3-hydroxy-3,4-dimethylpentyl)-1-methylbenzimidazol-2-one.
| Compound Name | 5-[(3-amino-2-chloro-4-pyridinyl)amino]-3-(3-hydroxy-3,4-dimethylpentyl)-1-methylbenzimidazol-2-one |
|---|---|
| PubChem CID | 142478603 |
| Molecular Formula | C20H26ClN5O2 |
| Molecular Weight | 403.91 g/mol |
| Exact Mass | 403.18 |
| IUPAC Name | 5-[(3-amino-2-chloro-4-pyridinyl)amino]-3-(3-hydroxy-3,4-dimethylpentyl)-1-methylbenzimidazol-2-one |
| SMILES | CC(C)C(C)(O)CCn1c(=O)n(C)c2ccc(Nc3ccnc(Cl)c3N)cc21 |
| InChI | InChI=1S/C20H26ClN5O2/c1-12(2)20(3,28)8-10-26-16-11-13(5-6-15(16)25(4)19(26)27)24-14-7-9-23-18(21)17(14)22/h5-7,9,11-12,28H,8,10,22H2,1-4H3,(H,23,24) |
| InChIKey | RVHCRWMBVMACTI-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 98.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.91 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|