C21H19ClN6O2 — CID 153408817
2-chloro-4-[[3-[(4-cyanooxan-4-yl)methyl]-1-methyl-2-oxobenzimidazol-5-yl]amino]pyridine-3-carbonitrile (PubChem CID 153408817) has the molecular formula C21H19ClN6O2 and a molecular weight of 422.88 g/mol. Its IUPAC name is 2-chloro-4-[[3-[(4-cyanooxan-4-yl)methyl]-1-methyl-2-oxobenzimidazol-5-yl]amino]pyridine-3-carbonitrile.
| Compound Name | 2-chloro-4-[[3-[(4-cyanooxan-4-yl)methyl]-1-methyl-2-oxobenzimidazol-5-yl]amino]pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 153408817 |
| Molecular Formula | C21H19ClN6O2 |
| Molecular Weight | 422.88 g/mol |
| Exact Mass | 422.13 |
| IUPAC Name | 2-chloro-4-[[3-[(4-cyanooxan-4-yl)methyl]-1-methyl-2-oxobenzimidazol-5-yl]amino]pyridine-3-carbonitrile |
| SMILES | Cn1c(=O)n(CC2(C#N)CCOCC2)c2cc(Nc3ccnc(Cl)c3C#N)ccc21 |
| InChI | InChI=1S/C21H19ClN6O2/c1-27-17-3-2-14(26-16-4-7-25-19(22)15(16)11-23)10-18(17)28(20(27)29)13-21(12-24)5-8-30-9-6-21/h2-4,7,10H,5-6,8-9,13H2,1H3,(H,25,26) |
| InChIKey | QSHKZQRHWFNNOT-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 108.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.88 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|