C32H32N4O5 — CID 142479062
4-[4-cyano-2-[2-[3-methyl-6-(2-phenoxyethylcarbamoyl)indol-1-yl]propanoylamino]phenyl]butanoic acid (PubChem CID 142479062) has the molecular formula C32H32N4O5 and a molecular weight of 552.63 g/mol. Its IUPAC name is 4-[4-cyano-2-[2-[3-methyl-6-(2-phenoxyethylcarbamoyl)indol-1-yl]propanoylamino]phenyl]butanoic acid.
| Compound Name | 4-[4-cyano-2-[2-[3-methyl-6-(2-phenoxyethylcarbamoyl)indol-1-yl]propanoylamino]phenyl]butanoic acid |
|---|---|
| PubChem CID | 142479062 |
| Molecular Formula | C32H32N4O5 |
| Molecular Weight | 552.63 g/mol |
| Exact Mass | 552.24 |
| IUPAC Name | 4-[4-cyano-2-[2-[3-methyl-6-(2-phenoxyethylcarbamoyl)indol-1-yl]propanoylamino]phenyl]butanoic acid |
| SMILES | Cc1cn(C(C)C(=O)Nc2cc(C#N)ccc2CCCC(=O)O)c2cc(C(=O)NCCOc3ccccc3)ccc12 |
| InChI | InChI=1S/C32H32N4O5/c1-21-20-36(22(2)31(39)35-28-17-23(19-33)11-12-24(28)7-6-10-30(37)38)29-18-25(13-14-27(21)29)32(40)34-15-16-41-26-8-4-3-5-9-26/h3-5,8-9,11-14,17-18,20,22H,6-7,10,15-16H2,1-2H3,(H,34,40)(H,35,39)(H,37,38) |
| InChIKey | KBGLEJWGRJGSAU-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 133.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.63 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|