C29H32N4O5 — CID 142478989
4-[4-cyano-2-[2-[3-cyclopropyl-6-(2-methoxyethylcarbamoyl)indol-1-yl]propanoylamino]phenyl]butanoic acid (PubChem CID 142478989) has the molecular formula C29H32N4O5 and a molecular weight of 516.60 g/mol. Its IUPAC name is 4-[4-cyano-2-[2-[3-cyclopropyl-6-(2-methoxyethylcarbamoyl)indol-1-yl]propanoylamino]phenyl]butanoic acid.
| Compound Name | 4-[4-cyano-2-[2-[3-cyclopropyl-6-(2-methoxyethylcarbamoyl)indol-1-yl]propanoylamino]phenyl]butanoic acid |
|---|---|
| PubChem CID | 142478989 |
| Molecular Formula | C29H32N4O5 |
| Molecular Weight | 516.60 g/mol |
| Exact Mass | 516.24 |
| IUPAC Name | 4-[4-cyano-2-[2-[3-cyclopropyl-6-(2-methoxyethylcarbamoyl)indol-1-yl]propanoylamino]phenyl]butanoic acid |
| SMILES | COCCNC(=O)c1ccc2c(C3CC3)cn(C(C)C(=O)Nc3cc(C#N)ccc3CCCC(=O)O)c2c1 |
| InChI | InChI=1S/C29H32N4O5/c1-18(28(36)32-25-14-19(16-30)6-7-21(25)4-3-5-27(34)35)33-17-24(20-8-9-20)23-11-10-22(15-26(23)33)29(37)31-12-13-38-2/h6-7,10-11,14-15,17-18,20H,3-5,8-9,12-13H2,1-2H3,(H,31,37)(H,32,36)(H,34,35) |
| InChIKey | VTAOFZCQTLIWNI-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 133.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.60 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|