C23H24N2O3 — CID 142479950
(2R)-2-amino-3-hydroxy-N-[3-[4-(2-phenylethyl)phenoxy]phenyl]propanamide (PubChem CID 142479950) has the molecular formula C23H24N2O3 and a molecular weight of 376.46 g/mol. Its IUPAC name is (2R)-2-amino-3-hydroxy-N-[3-[4-(2-phenylethyl)phenoxy]phenyl]propanamide.
| Compound Name | (2R)-2-amino-3-hydroxy-N-[3-[4-(2-phenylethyl)phenoxy]phenyl]propanamide |
|---|---|
| PubChem CID | 142479950 |
| Molecular Formula | C23H24N2O3 |
| Molecular Weight | 376.46 g/mol |
| Exact Mass | 376.18 |
| IUPAC Name | (2R)-2-amino-3-hydroxy-N-[3-[4-(2-phenylethyl)phenoxy]phenyl]propanamide |
| SMILES | N[C@H](CO)C(=O)Nc1cccc(Oc2ccc(CCc3ccccc3)cc2)c1 |
| InChI | InChI=1S/C23H24N2O3/c24-22(16-26)23(27)25-19-7-4-8-21(15-19)28-20-13-11-18(12-14-20)10-9-17-5-2-1-3-6-17/h1-8,11-15,22,26H,9-10,16,24H2,(H,25,27)/t22-/m1/s1 |
| InChIKey | QDNFUGWXEZESFF-JOCHJYFZSA-N |
| XLogP | 3.52 |
| TPSA | 84.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.46 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |