C22H21ClN2O2 — CID 67010614
(2S)-2-amino-N-[4-(4-chlorophenoxy)phenyl]-4-phenylbutanamide (PubChem CID 67010614) has the molecular formula C22H21ClN2O2 and a molecular weight of 380.88 g/mol. Its IUPAC name is (2S)-2-amino-N-[4-(4-chlorophenoxy)phenyl]-4-phenylbutanamide.
| Compound Name | (2S)-2-amino-N-[4-(4-chlorophenoxy)phenyl]-4-phenylbutanamide |
|---|---|
| PubChem CID | 67010614 |
| Molecular Formula | C22H21ClN2O2 |
| Molecular Weight | 380.88 g/mol |
| Exact Mass | 380.13 |
| IUPAC Name | (2S)-2-amino-N-[4-(4-chlorophenoxy)phenyl]-4-phenylbutanamide |
| SMILES | N[C@@H](CCc1ccccc1)C(=O)Nc1ccc(Oc2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C22H21ClN2O2/c23-17-7-11-19(12-8-17)27-20-13-9-18(10-14-20)25-22(26)21(24)15-6-16-4-2-1-3-5-16/h1-5,7-14,21H,6,15,24H2,(H,25,26)/t21-/m0/s1 |
| InChIKey | LAYXOSPOFZQZNO-NRFANRHFSA-N |
| XLogP | 5.03 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.88 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |