C26H27ClN4O3 — CID 91444596
2-[(4-amino-3-iminobutanoyl)amino]-N-[4-(4-chlorophenoxy)phenyl]-4-phenylbutanamide (PubChem CID 91444596) has the molecular formula C26H27ClN4O3 and a molecular weight of 478.98 g/mol. Its IUPAC name is 2-[(4-amino-3-iminobutanoyl)amino]-N-[4-(4-chlorophenoxy)phenyl]-4-phenylbutanamide.
| Compound Name | 2-[(4-amino-3-iminobutanoyl)amino]-N-[4-(4-chlorophenoxy)phenyl]-4-phenylbutanamide |
|---|---|
| PubChem CID | 91444596 |
| Molecular Formula | C26H27ClN4O3 |
| Molecular Weight | 478.98 g/mol |
| Exact Mass | 478.18 |
| IUPAC Name | 2-[(4-amino-3-iminobutanoyl)amino]-N-[4-(4-chlorophenoxy)phenyl]-4-phenylbutanamide |
| SMILES | [H]/N=C(\CN)CC(=O)NC(CCc1ccccc1)C(=O)Nc1ccc(Oc2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C26H27ClN4O3/c27-19-7-11-22(12-8-19)34-23-13-9-21(10-14-23)30-26(33)24(31-25(32)16-20(29)17-28)15-6-18-4-2-1-3-5-18/h1-5,7-14,24,29H,6,15-17,28H2,(H,30,33)(H,31,32)/b29-20- |
| InChIKey | CZRFQKMHFDESIR-BRPDVVIDSA-N |
| XLogP | 4.56 |
| TPSA | 117.30 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.98 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|