C20H23ClN2O2 — CID 7316761
N-(4-chlorophenyl)-N'-[(2S)-4-phenylbutan-2-yl]butanediamide (PubChem CID 7316761) has the molecular formula C20H23ClN2O2 and a molecular weight of 358.87 g/mol. Its IUPAC name is N-(4-chlorophenyl)-N'-[(2S)-4-phenylbutan-2-yl]butanediamide.
| Compound Name | N-(4-chlorophenyl)-N'-[(2S)-4-phenylbutan-2-yl]butanediamide |
|---|---|
| PubChem CID | 7316761 |
| Molecular Formula | C20H23ClN2O2 |
| Molecular Weight | 358.87 g/mol |
| Exact Mass | 358.14 |
| IUPAC Name | N-(4-chlorophenyl)-N'-[(2S)-4-phenylbutan-2-yl]butanediamide |
| SMILES | C[C@@H](CCc1ccccc1)NC(=O)CCC(=O)Nc1ccc(Cl)cc1 |
| InChI | InChI=1S/C20H23ClN2O2/c1-15(7-8-16-5-3-2-4-6-16)22-19(24)13-14-20(25)23-18-11-9-17(21)10-12-18/h2-6,9-12,15H,7-8,13-14H2,1H3,(H,22,24)(H,23,25)/t15-/m0/s1 |
| InChIKey | OAKHBFOEGJTVPH-HNNXBMFYSA-N |
| XLogP | 4.20 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.87 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |