C25H34N2O2 — CID 7324001
(3R)-3-methyl-N-[(2R)-4-phenylbutan-2-yl]-N'-(4-propan-2-ylphenyl)pentanediamide (PubChem CID 7324001) has the molecular formula C25H34N2O2 and a molecular weight of 394.56 g/mol. Its IUPAC name is (3R)-3-methyl-N-[(2R)-4-phenylbutan-2-yl]-N'-(4-propan-2-ylphenyl)pentanediamide.
| Compound Name | (3R)-3-methyl-N-[(2R)-4-phenylbutan-2-yl]-N'-(4-propan-2-ylphenyl)pentanediamide |
|---|---|
| PubChem CID | 7324001 |
| Molecular Formula | C25H34N2O2 |
| Molecular Weight | 394.56 g/mol |
| Exact Mass | 394.26 |
| IUPAC Name | (3R)-3-methyl-N-[(2R)-4-phenylbutan-2-yl]-N'-(4-propan-2-ylphenyl)pentanediamide |
| SMILES | CC(C)c1ccc(NC(=O)C[C@H](C)CC(=O)N[C@H](C)CCc2ccccc2)cc1 |
| InChI | InChI=1S/C25H34N2O2/c1-18(2)22-12-14-23(15-13-22)27-25(29)17-19(3)16-24(28)26-20(4)10-11-21-8-6-5-7-9-21/h5-9,12-15,18-20H,10-11,16-17H2,1-4H3,(H,26,28)(H,27,29)/t19-,20-/m1/s1 |
| InChIKey | SFXMBSZGVOBVCX-WOJBJXKFSA-N |
| XLogP | 5.30 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.56 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |