C22H21ClN2O3 — CID 67009405
(2S)-2-amino-N-[4-(4-chlorophenoxy)phenyl]-3-phenylmethoxypropanamide (PubChem CID 67009405) has the molecular formula C22H21ClN2O3 and a molecular weight of 396.87 g/mol. Its IUPAC name is (2S)-2-amino-N-[4-(4-chlorophenoxy)phenyl]-3-phenylmethoxypropanamide.
| Compound Name | (2S)-2-amino-N-[4-(4-chlorophenoxy)phenyl]-3-phenylmethoxypropanamide |
|---|---|
| PubChem CID | 67009405 |
| Molecular Formula | C22H21ClN2O3 |
| Molecular Weight | 396.87 g/mol |
| Exact Mass | 396.12 |
| IUPAC Name | (2S)-2-amino-N-[4-(4-chlorophenoxy)phenyl]-3-phenylmethoxypropanamide |
| SMILES | N[C@@H](COCc1ccccc1)C(=O)Nc1ccc(Oc2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C22H21ClN2O3/c23-17-6-10-19(11-7-17)28-20-12-8-18(9-13-20)25-22(26)21(24)15-27-14-16-4-2-1-3-5-16/h1-13,21H,14-15,24H2,(H,25,26)/t21-/m0/s1 |
| InChIKey | LPTBQOYWPPZZFI-NRFANRHFSA-N |
| XLogP | 4.61 |
| TPSA | 73.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.87 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |