C16H19N3O2 — CID 142480000
(2R)-2-amino-N-[[4-(4-aminophenyl)phenyl]methyl]-3-hydroxypropanamide (PubChem CID 142480000) has the molecular formula C16H19N3O2 and a molecular weight of 285.35 g/mol. Its IUPAC name is (2R)-2-amino-N-[[4-(4-aminophenyl)phenyl]methyl]-3-hydroxypropanamide.
| Compound Name | (2R)-2-amino-N-[[4-(4-aminophenyl)phenyl]methyl]-3-hydroxypropanamide |
|---|---|
| PubChem CID | 142480000 |
| Molecular Formula | C16H19N3O2 |
| Molecular Weight | 285.35 g/mol |
| Exact Mass | 285.15 |
| IUPAC Name | (2R)-2-amino-N-[[4-(4-aminophenyl)phenyl]methyl]-3-hydroxypropanamide |
| SMILES | Nc1ccc(-c2ccc(CNC(=O)[C@H](N)CO)cc2)cc1 |
| InChI | InChI=1S/C16H19N3O2/c17-14-7-5-13(6-8-14)12-3-1-11(2-4-12)9-19-16(21)15(18)10-20/h1-8,15,20H,9-10,17-18H2,(H,19,21)/t15-/m1/s1 |
| InChIKey | MKNSOQSJQIEMNU-OAHLLOKOSA-N |
| XLogP | 0.87 |
| TPSA | 101.37 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.35 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|