C11H12ClF3N2O2 — CID 70925766
2-amino-N-[[4-chloro-3-(trifluoromethyl)phenyl]methyl]-3-hydroxypropanamide (PubChem CID 70925766) has the molecular formula C11H12ClF3N2O2 and a molecular weight of 296.68 g/mol. Its IUPAC name is 2-amino-N-[[4-chloro-3-(trifluoromethyl)phenyl]methyl]-3-hydroxypropanamide.
| Compound Name | 2-amino-N-[[4-chloro-3-(trifluoromethyl)phenyl]methyl]-3-hydroxypropanamide |
|---|---|
| PubChem CID | 70925766 |
| Molecular Formula | C11H12ClF3N2O2 |
| Molecular Weight | 296.68 g/mol |
| Exact Mass | 296.05 |
| IUPAC Name | 2-amino-N-[[4-chloro-3-(trifluoromethyl)phenyl]methyl]-3-hydroxypropanamide |
| SMILES | NC(CO)C(=O)NCc1ccc(Cl)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C11H12ClF3N2O2/c12-8-2-1-6(3-7(8)11(13,14)15)4-17-10(19)9(16)5-18/h1-3,9,18H,4-5,16H2,(H,17,19) |
| InChIKey | OOBZCKKRVUYTMC-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 75.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.68 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |