C15H22F3N3O2S — CID 142480012
(2R)-2-amino-3-[2-[(Z)-ethylidene(methyl)-λ4-sulfanyl]ethylamino]-N-[3-(trifluoromethoxy)phenyl]propanamide (PubChem CID 142480012) has the molecular formula C15H22F3N3O2S and a molecular weight of 365.42 g/mol. Its IUPAC name is (2R)-2-amino-3-[2-[(Z)-ethylidene(methyl)-λ4-sulfanyl]ethylamino]-N-[3-(trifluoromethoxy)phenyl]propanamide.
| Compound Name | (2R)-2-amino-3-[2-[(Z)-ethylidene(methyl)-λ4-sulfanyl]ethylamino]-N-[3-(trifluoromethoxy)phenyl]propanamide |
|---|---|
| PubChem CID | 142480012 |
| Molecular Formula | C15H22F3N3O2S |
| Molecular Weight | 365.42 g/mol |
| Exact Mass | 365.14 |
| IUPAC Name | (2R)-2-amino-3-[2-[(Z)-ethylidene(methyl)-λ4-sulfanyl]ethylamino]-N-[3-(trifluoromethoxy)phenyl]propanamide |
| SMILES | C/C=S(/C)CCNC[C@@H](N)C(=O)Nc1cccc(OC(F)(F)F)c1 |
| InChI | InChI=1S/C15H22F3N3O2S/c1-3-24(2)8-7-20-10-13(19)14(22)21-11-5-4-6-12(9-11)23-15(16,17)18/h3-6,9,13,20H,7-8,10,19H2,1-2H3,(H,21,22)/t13-,24?/m1/s1 |
| InChIKey | KWDAFXJIJKEYAV-SGZRZGDHSA-N |
| XLogP | 2.16 |
| TPSA | 76.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.42 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thio_aldehyd_A(3)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|