About N-[4-(4-chlorophenyl)butyl]-N-ethenyl-N'-methylmethanimidamide
N-[4-(4-chlorophenyl)butyl]-N-ethenyl-N'-methylmethanimidamide (PubChem CID 142480219) has the molecular formula C14H19ClN2
and a molecular weight of 250.77 g/mol. Its IUPAC name is N-[4-(4-chlorophenyl)butyl]-N-ethenyl-N'-methylmethanimidamide.
Molecular Properties
| Compound Name | N-[4-(4-chlorophenyl)butyl]-N-ethenyl-N'-methylmethanimidamide |
| PubChem CID | 142480219 |
| Molecular Formula | C14H19ClN2 |
| Molecular Weight | 250.77 g/mol |
| Exact Mass | 250.12 |
| IUPAC Name | N-[4-(4-chlorophenyl)butyl]-N-ethenyl-N'-methylmethanimidamide |
| SMILES | C=CN(/C=N/C)CCCCc1ccc(Cl)cc1 |
| InChI | InChI=1S/C14H19ClN2/c1-3-17(12-16-2)11-5-4-6-13-7-9-14(15)10-8-13/h3,7-10,12H,1,4-6,11H2,2H3/b16-12+ |
| InChIKey | NYFWCHRZXXHPIZ-FOWTUZBSSA-N |
| XLogP | 3.77 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 250.77 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze N-[4-(4-chlorophenyl)butyl]-N-ethenyl-N'-methylmethanimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[4-(4-chlorophenyl)butyl]-N-ethenyl-N'-methylmethanimidamide?
The IUPAC name of N-[4-(4-chlorophenyl)butyl]-N-ethenyl-N'-methylmethanimidamide (CID 142480219) is N-[4-(4-chlorophenyl)butyl]-N-ethenyl-N'-methylmethanimidamide.
What is the SMILES notation for N-[4-(4-chlorophenyl)butyl]-N-ethenyl-N'-methylmethanimidamide?
The canonical SMILES for N-[4-(4-chlorophenyl)butyl]-N-ethenyl-N'-methylmethanimidamide is C=CN(/C=N/C)CCCCc1ccc(Cl)cc1.
What is the InChIKey of N-[4-(4-chlorophenyl)butyl]-N-ethenyl-N'-methylmethanimidamide?
The InChIKey is NYFWCHRZXXHPIZ-FOWTUZBSSA-N. The full InChI is InChI=1S/C14H19ClN2/c1-3-17(12-16-2)11-5-4-6-13-7-9-14(15)10-8-13/h3,7-10,12H,1,4-6,11H2,2H3/b16-12+.
What are the key properties of N-[4-(4-chlorophenyl)butyl]-N-ethenyl-N'-methylmethanimidamide?
N-[4-(4-chlorophenyl)butyl]-N-ethenyl-N'-methylmethanimidamide has a molecular weight of 250.77 g/mol, XLogP of 3.77, 7 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-[4-(4-chlorophenyl)butyl]-N-ethenyl-N'-methylmethanimidamide is sourced from PubChem (CID 142480219), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).