C11H15ClN2 — CID 132967057
N'-[2-(4-chlorophenyl)ethyl]-N,N-dimethylmethanimidamide (PubChem CID 132967057) has the molecular formula C11H15ClN2 and a molecular weight of 210.71 g/mol. Its IUPAC name is N'-[2-(4-chlorophenyl)ethyl]-N,N-dimethylmethanimidamide.
| Compound Name | N'-[2-(4-chlorophenyl)ethyl]-N,N-dimethylmethanimidamide |
|---|---|
| PubChem CID | 132967057 |
| Molecular Formula | C11H15ClN2 |
| Molecular Weight | 210.71 g/mol |
| Exact Mass | 210.09 |
| IUPAC Name | N'-[2-(4-chlorophenyl)ethyl]-N,N-dimethylmethanimidamide |
| SMILES | CN(C)/C=N/CCc1ccc(Cl)cc1 |
| InChI | InChI=1S/C11H15ClN2/c1-14(2)9-13-8-7-10-3-5-11(12)6-4-10/h3-6,9H,7-8H2,1-2H3/b13-9+ |
| InChIKey | GGZTWVWNCQYCRJ-UKTHLTGXSA-N |
| XLogP | 2.47 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.71 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|