C51H39N3 — CID 142481612
[(3Z,5Z)-2-methylidene-1-phenyl-6'-(9-phenyl-3,4-dihydrocarbazol-2-yl)spiro[7H-1-benzazecine-8,9'-fluorene]-4'-yl]methanimine (PubChem CID 142481612) has the molecular formula C51H39N3 and a molecular weight of 693.89 g/mol. Its IUPAC name is [(3Z,5Z)-2-methylidene-1-phenyl-6'-(9-phenyl-3,4-dihydrocarbazol-2-yl)spiro[7H-1-benzazecine-8,9'-fluorene]-4'-yl]methanimine.
| Compound Name | [(3Z,5Z)-2-methylidene-1-phenyl-6'-(9-phenyl-3,4-dihydrocarbazol-2-yl)spiro[7H-1-benzazecine-8,9'-fluorene]-4'-yl]methanimine |
|---|---|
| PubChem CID | 142481612 |
| Molecular Formula | C51H39N3 |
| Molecular Weight | 693.89 g/mol |
| Exact Mass | 693.31 |
| IUPAC Name | [(3Z,5Z)-2-methylidene-1-phenyl-6'-(9-phenyl-3,4-dihydrocarbazol-2-yl)spiro[7H-1-benzazecine-8,9'-fluorene]-4'-yl]methanimine |
| SMILES | [H]/N=C\c1cccc2c1-c1cc(C3=Cc4c(c5ccccc5n4-c4ccccc4)CC3)ccc1C21C/C=C\C=C/C(=C)N(c2ccccc2)c2ccccc21 |
| InChI | InChI=1S/C51H39N3/c1-35-16-5-4-14-31-51(45-23-11-13-26-48(45)53(35)39-18-6-2-7-19-39)44-30-28-36(32-43(44)50-38(34-52)17-15-24-46(50)51)37-27-29-42-41-22-10-12-25-47(41)54(49(42)33-37)40-20-8-3-9-21-40/h2-26,28,30,32-34,52H,1,27,29,31H2/b14-4-,16-5-,52-34- |
| InChIKey | YIFCIXLTLJORTI-VGJRUAGYSA-N |
| XLogP | 12.60 |
| TPSA | 32.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 693.89 |
| LogP ≤ 5 | 12.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|