C10H14O2 — CID 142482257
1-(cyclohexa-1,5-dien-1-ylmethoxy)propan-2-one (PubChem CID 142482257) has the molecular formula C10H14O2 and a molecular weight of 166.22 g/mol. Its IUPAC name is 1-(cyclohexa-1,5-dien-1-ylmethoxy)propan-2-one.
| Compound Name | 1-(cyclohexa-1,5-dien-1-ylmethoxy)propan-2-one |
|---|---|
| PubChem CID | 142482257 |
| Molecular Formula | C10H14O2 |
| Molecular Weight | 166.22 g/mol |
| Exact Mass | 166.10 |
| IUPAC Name | 1-(cyclohexa-1,5-dien-1-ylmethoxy)propan-2-one |
| SMILES | CC(=O)COCC1=CCCC=C1 |
| InChI | InChI=1S/C10H14O2/c1-9(11)7-12-8-10-5-3-2-4-6-10/h3,5-6H,2,4,7-8H2,1H3 |
| InChIKey | SDNQYSUSRBUXMB-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.22 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |