C9H12O2 — CID 23166254
1-cyclohexa-1,5-dien-1-yloxypropan-2-one (PubChem CID 23166254) has the molecular formula C9H12O2 and a molecular weight of 152.19 g/mol. Its IUPAC name is 1-cyclohexa-1,5-dien-1-yloxypropan-2-one.
| Compound Name | 1-cyclohexa-1,5-dien-1-yloxypropan-2-one |
|---|---|
| PubChem CID | 23166254 |
| Molecular Formula | C9H12O2 |
| Molecular Weight | 152.19 g/mol |
| Exact Mass | 152.08 |
| IUPAC Name | 1-cyclohexa-1,5-dien-1-yloxypropan-2-one |
| SMILES | CC(=O)COC1=CCCC=C1 |
| InChI | InChI=1S/C9H12O2/c1-8(10)7-11-9-5-3-2-4-6-9/h3,5-6H,2,4,7H2,1H3 |
| InChIKey | KCTIRGMOFPJZJG-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 152.19 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |