C10H12O3 — CID 166464886
cyclohexa-1,5-dien-1-yl 4-oxobutanoate (PubChem CID 166464886) has the molecular formula C10H12O3 and a molecular weight of 180.20 g/mol. Its IUPAC name is cyclohexa-1,5-dien-1-yl 4-oxobutanoate.
| Compound Name | cyclohexa-1,5-dien-1-yl 4-oxobutanoate |
|---|---|
| PubChem CID | 166464886 |
| Molecular Formula | C10H12O3 |
| Molecular Weight | 180.20 g/mol |
| Exact Mass | 180.08 |
| IUPAC Name | cyclohexa-1,5-dien-1-yl 4-oxobutanoate |
| SMILES | O=CCCC(=O)OC1=CCCC=C1 |
| InChI | InChI=1S/C10H12O3/c11-8-4-7-10(12)13-9-5-2-1-3-6-9/h2,5-6,8H,1,3-4,7H2 |
| InChIKey | KVZWQOKGKTWTNI-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.20 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|