About 4-cyclohexa-1,5-dien-1-yloxyphenol
4-cyclohexa-1,5-dien-1-yloxyphenol (PubChem CID 129018393) has the molecular formula C12H12O2
and a molecular weight of 188.23 g/mol. Its IUPAC name is 4-cyclohexa-1,5-dien-1-yloxyphenol.
Molecular Properties
| Compound Name | 4-cyclohexa-1,5-dien-1-yloxyphenol |
| PubChem CID | 129018393 |
| Molecular Formula | C12H12O2 |
| Molecular Weight | 188.23 g/mol |
| Exact Mass | 188.08 |
| IUPAC Name | 4-cyclohexa-1,5-dien-1-yloxyphenol |
| SMILES | Oc1ccc(OC2=CCCC=C2)cc1 |
| InChI | InChI=1S/C12H12O2/c13-10-6-8-12(9-7-10)14-11-4-2-1-3-5-11/h2,4-9,13H,1,3H2 |
| InChIKey | DFEWVWPZLYHMKP-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 188.23 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-cyclohexa-1,5-dien-1-yloxyphenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-cyclohexa-1,5-dien-1-yloxyphenol?
The IUPAC name of 4-cyclohexa-1,5-dien-1-yloxyphenol (CID 129018393) is 4-cyclohexa-1,5-dien-1-yloxyphenol.
What is the SMILES notation for 4-cyclohexa-1,5-dien-1-yloxyphenol?
The canonical SMILES for 4-cyclohexa-1,5-dien-1-yloxyphenol is Oc1ccc(OC2=CCCC=C2)cc1.
What is the InChIKey of 4-cyclohexa-1,5-dien-1-yloxyphenol?
The InChIKey is DFEWVWPZLYHMKP-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H12O2/c13-10-6-8-12(9-7-10)14-11-4-2-1-3-5-11/h2,4-9,13H,1,3H2.
What are the key properties of 4-cyclohexa-1,5-dien-1-yloxyphenol?
4-cyclohexa-1,5-dien-1-yloxyphenol has a molecular weight of 188.23 g/mol, XLogP of 3.00, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-cyclohexa-1,5-dien-1-yloxyphenol is sourced from PubChem (CID 129018393), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).