About 4-ethoxyphenol
4-ethoxyphenol (PubChem CID 12150) has the molecular formula C8H10O2
and a molecular weight of 138.17 g/mol. Its IUPAC name is 4-ethoxyphenol.
Molecular Properties
| Compound Name | 4-ethoxyphenol |
| PubChem CID | 12150 |
| Molecular Formula | C8H10O2 |
| Molecular Weight | 138.17 g/mol |
| Exact Mass | 138.07 |
| IUPAC Name | 4-ethoxyphenol |
| SMILES | CCOc1ccc(O)cc1 |
| InChI | InChI=1S/C8H10O2/c1-2-10-8-5-3-7(9)4-6-8/h3-6,9H,2H2,1H3 |
| InChIKey | LKVFCSWBKOVHAH-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 138.17 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-ethoxyphenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-ethoxyphenol?
The IUPAC name of 4-ethoxyphenol (CID 12150) is 4-ethoxyphenol.
What is the SMILES notation for 4-ethoxyphenol?
The canonical SMILES for 4-ethoxyphenol is CCOc1ccc(O)cc1.
What is the InChIKey of 4-ethoxyphenol?
The InChIKey is LKVFCSWBKOVHAH-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10O2/c1-2-10-8-5-3-7(9)4-6-8/h3-6,9H,2H2,1H3.
What are the key properties of 4-ethoxyphenol?
4-ethoxyphenol has a molecular weight of 138.17 g/mol, XLogP of 1.79, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-ethoxyphenol is sourced from PubChem (CID 12150), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).