About 2-Ethoxyphenol
2-Ethoxyphenol (PubChem CID 66755) has the molecular formula C8H10O2
and a molecular weight of 138.16 g/mol. Its IUPAC name is 2-ethoxyphenol.
Molecular Properties
| Compound Name | 2-Ethoxyphenol |
| PubChem CID | 66755 |
| Molecular Formula | C8H10O2 |
| Molecular Weight | 138.16 g/mol |
| Exact Mass | 138.07 |
| IUPAC Name | 2-ethoxyphenol |
| SMILES | CCOC1=CC=CC=C1O |
| InChI | InChI=1S/C8H10O2/c1-2-10-8-6-4-3-5-7(8)9/h3-6,9H,2H2,1H3 |
| InChIKey | MOEFFSWKSMRFRQ-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 29.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | 93 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 138.16 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-Ethoxyphenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-Ethoxyphenol?
The IUPAC name of 2-Ethoxyphenol (CID 66755) is 2-ethoxyphenol.
What is the SMILES notation for 2-Ethoxyphenol?
The canonical SMILES for 2-Ethoxyphenol is CCOC1=CC=CC=C1O.
What is the InChIKey of 2-Ethoxyphenol?
The InChIKey is MOEFFSWKSMRFRQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10O2/c1-2-10-8-6-4-3-5-7(8)9/h3-6,9H,2H2,1H3.
What are the key properties of 2-Ethoxyphenol?
2-Ethoxyphenol has a molecular weight of 138.16 g/mol, XLogP of 1.70, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-Ethoxyphenol is sourced from PubChem (CID 66755), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).