About 2-Phenoxy-1-propanol
2-Phenoxy-1-propanol (PubChem CID 20129) has the molecular formula C9H12O2
and a molecular weight of 152.19 g/mol. Its IUPAC name is 2-phenoxypropan-1-ol.
Molecular Properties
| Compound Name | 2-Phenoxy-1-propanol |
| PubChem CID | 20129 |
| Molecular Formula | C9H12O2 |
| Molecular Weight | 152.19 g/mol |
| Exact Mass | 152.08 |
| IUPAC Name | 2-phenoxypropan-1-ol |
| SMILES | CC(CO)OC1=CC=CC=C1 |
| InChI | InChI=1S/C9H12O2/c1-8(7-10)11-9-5-3-2-4-6-9/h2-6,8,10H,7H2,1H3 |
| InChIKey | LOJHHQNEBFCTQK-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 29.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | 97 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 152.19 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-Phenoxy-1-propanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-Phenoxy-1-propanol?
The IUPAC name of 2-Phenoxy-1-propanol (CID 20129) is 2-phenoxypropan-1-ol.
What is the SMILES notation for 2-Phenoxy-1-propanol?
The canonical SMILES for 2-Phenoxy-1-propanol is CC(CO)OC1=CC=CC=C1.
What is the InChIKey of 2-Phenoxy-1-propanol?
The InChIKey is LOJHHQNEBFCTQK-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12O2/c1-8(7-10)11-9-5-3-2-4-6-9/h2-6,8,10H,7H2,1H3.
What are the key properties of 2-Phenoxy-1-propanol?
2-Phenoxy-1-propanol has a molecular weight of 152.19 g/mol, XLogP of 1.60, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-Phenoxy-1-propanol is sourced from PubChem (CID 20129), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).