C9H13N3O2 — CID 174379121
cyclohexa-1,5-dien-1-yl 2-(diaminomethylideneamino)acetate (PubChem CID 174379121) has the molecular formula C9H13N3O2 and a molecular weight of 195.22 g/mol. Its IUPAC name is cyclohexa-1,5-dien-1-yl 2-(diaminomethylideneamino)acetate.
| Compound Name | cyclohexa-1,5-dien-1-yl 2-(diaminomethylideneamino)acetate |
|---|---|
| PubChem CID | 174379121 |
| Molecular Formula | C9H13N3O2 |
| Molecular Weight | 195.22 g/mol |
| Exact Mass | 195.10 |
| IUPAC Name | cyclohexa-1,5-dien-1-yl 2-(diaminomethylideneamino)acetate |
| SMILES | NC(N)=NCC(=O)OC1=CCCC=C1 |
| InChI | InChI=1S/C9H13N3O2/c10-9(11)12-6-8(13)14-7-4-2-1-3-5-7/h2,4-5H,1,3,6H2,(H4,10,11,12) |
| InChIKey | OYLIDLZQOHUNGB-UHFFFAOYSA-N |
| XLogP | 0.04 |
| TPSA | 90.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.22 |
| LogP ≤ 5 | 0.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|