C19H19F3N6O4 — CID 142482899
1-[4-[[2-(C-methanimidoyloxycarbonimidoyl)-4-(trifluoromethyl)phenyl]methyl]piperazine-1-carbonyl]pyrazole-3-carboxylic acid (PubChem CID 142482899) has the molecular formula C19H19F3N6O4 and a molecular weight of 452.39 g/mol. Its IUPAC name is 1-[4-[[2-(C-methanimidoyloxycarbonimidoyl)-4-(trifluoromethyl)phenyl]methyl]piperazine-1-carbonyl]pyrazole-3-carboxylic acid.
| Compound Name | 1-[4-[[2-(C-methanimidoyloxycarbonimidoyl)-4-(trifluoromethyl)phenyl]methyl]piperazine-1-carbonyl]pyrazole-3-carboxylic acid |
|---|---|
| PubChem CID | 142482899 |
| Molecular Formula | C19H19F3N6O4 |
| Molecular Weight | 452.39 g/mol |
| Exact Mass | 452.14 |
| IUPAC Name | 1-[4-[[2-(C-methanimidoyloxycarbonimidoyl)-4-(trifluoromethyl)phenyl]methyl]piperazine-1-carbonyl]pyrazole-3-carboxylic acid |
| SMILES | [H]/N=C(\O/C=N/[H])c1cc(C(F)(F)F)ccc1CN1CCN(C(=O)n2ccc(C(=O)O)n2)CC1 |
| InChI | InChI=1S/C19H19F3N6O4/c20-19(21,22)13-2-1-12(14(9-13)16(24)32-11-23)10-26-5-7-27(8-6-26)18(31)28-4-3-15(25-28)17(29)30/h1-4,9,11,23-24H,5-8,10H2,(H,29,30)/b23-11+,24-16- |
| InChIKey | IQVAZXLAPSMQNU-KGPKKXBQSA-N |
| XLogP | 2.34 |
| TPSA | 135.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.39 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|