About 1,4-dimethylcyclohexan-1-ol;ethane;1-methyl-4-propan-2-ylpiperidine
1,4-dimethylcyclohexan-1-ol;ethane;1-methyl-4-propan-2-ylpiperidine (PubChem CID 142483448) has the molecular formula C19H41NO
and a molecular weight of 299.54 g/mol. Its IUPAC name is 1,4-dimethylcyclohexan-1-ol;ethane;1-methyl-4-propan-2-ylpiperidine.
Molecular Properties
| Compound Name | 1,4-dimethylcyclohexan-1-ol;ethane;1-methyl-4-propan-2-ylpiperidine |
| PubChem CID | 142483448 |
| Molecular Formula | C19H41NO |
| Molecular Weight | 299.54 g/mol |
| Exact Mass | 299.32 |
| IUPAC Name | 1,4-dimethylcyclohexan-1-ol;ethane;1-methyl-4-propan-2-ylpiperidine |
| SMILES | CC.CC(C)C1CCN(C)CC1.CC1CCC(C)(O)CC1 |
| InChI | InChI=1S/C9H19N.C8H16O.C2H6/c1-8(2)9-4-6-10(3)7-5-9;1-7-3-5-8(2,9)6-4-7;1-2/h8-9H,4-7H2,1-3H3;7,9H,3-6H2,1-2H3;1-2H3 |
| InChIKey | OBYLQBZSDXNQLX-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 299.54 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1,4-dimethylcyclohexan-1-ol;ethane;1-methyl-4-propan-2-ylpiperidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,4-dimethylcyclohexan-1-ol;ethane;1-methyl-4-propan-2-ylpiperidine?
The IUPAC name of 1,4-dimethylcyclohexan-1-ol;ethane;1-methyl-4-propan-2-ylpiperidine (CID 142483448) is 1,4-dimethylcyclohexan-1-ol;ethane;1-methyl-4-propan-2-ylpiperidine.
What is the SMILES notation for 1,4-dimethylcyclohexan-1-ol;ethane;1-methyl-4-propan-2-ylpiperidine?
The canonical SMILES for 1,4-dimethylcyclohexan-1-ol;ethane;1-methyl-4-propan-2-ylpiperidine is CC.CC(C)C1CCN(C)CC1.CC1CCC(C)(O)CC1.
What is the InChIKey of 1,4-dimethylcyclohexan-1-ol;ethane;1-methyl-4-propan-2-ylpiperidine?
The InChIKey is OBYLQBZSDXNQLX-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H19N.C8H16O.C2H6/c1-8(2)9-4-6-10(3)7-5-9;1-7-3-5-8(2,9)6-4-7;1-2/h8-9H,4-7H2,1-3H3;7,9H,3-6H2,1-2H3;1-2H3.
What are the key properties of 1,4-dimethylcyclohexan-1-ol;ethane;1-methyl-4-propan-2-ylpiperidine?
1,4-dimethylcyclohexan-1-ol;ethane;1-methyl-4-propan-2-ylpiperidine has a molecular weight of 299.54 g/mol, XLogP of 4.96, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1,4-dimethylcyclohexan-1-ol;ethane;1-methyl-4-propan-2-ylpiperidine is sourced from PubChem (CID 142483448), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).