C15H22O8S — CID 142484185
[3,5-diacetyloxy-4-(2-oxopropyl)-6-sulfanyloxan-2-yl]methyl acetate (PubChem CID 142484185) has the molecular formula C15H22O8S and a molecular weight of 362.40 g/mol. Its IUPAC name is [3,5-diacetyloxy-4-(2-oxopropyl)-6-sulfanyloxan-2-yl]methyl acetate.
| Compound Name | [3,5-diacetyloxy-4-(2-oxopropyl)-6-sulfanyloxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 142484185 |
| Molecular Formula | C15H22O8S |
| Molecular Weight | 362.40 g/mol |
| Exact Mass | 362.10 |
| IUPAC Name | [3,5-diacetyloxy-4-(2-oxopropyl)-6-sulfanyloxan-2-yl]methyl acetate |
| SMILES | CC(=O)CC1C(OC(C)=O)C(S)OC(COC(C)=O)C1OC(C)=O |
| InChI | InChI=1S/C15H22O8S/c1-7(16)5-11-13(21-9(3)18)12(6-20-8(2)17)23-15(24)14(11)22-10(4)19/h11-15,24H,5-6H2,1-4H3 |
| InChIKey | ZQMPUNHFOMEVCE-UHFFFAOYSA-N |
| XLogP | 0.66 |
| TPSA | 105.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.40 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|