C26H13F9N2O2S — CID 142488001
[1-(1,10-phenanthrolin-2-yl)naphthalen-2-yl] 1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulfinate (PubChem CID 142488001) has the molecular formula C26H13F9N2O2S and a molecular weight of 588.45 g/mol. Its IUPAC name is [1-(1,10-phenanthrolin-2-yl)naphthalen-2-yl] 1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulfinate.
| Compound Name | [1-(1,10-phenanthrolin-2-yl)naphthalen-2-yl] 1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulfinate |
|---|---|
| PubChem CID | 142488001 |
| Molecular Formula | C26H13F9N2O2S |
| Molecular Weight | 588.45 g/mol |
| Exact Mass | 588.06 |
| IUPAC Name | [1-(1,10-phenanthrolin-2-yl)naphthalen-2-yl] 1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulfinate |
| SMILES | O=S(Oc1ccc2ccccc2c1-c1ccc2ccc3cccnc3c2n1)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C26H13F9N2O2S/c27-23(28,25(31,32)33)24(29,30)26(34,35)40(38)39-19-12-10-14-4-1-2-6-17(14)20(19)18-11-9-16-8-7-15-5-3-13-36-21(15)22(16)37-18/h1-13H |
| InChIKey | BVWSHWTVCCVKAT-UHFFFAOYSA-N |
| XLogP | 8.07 |
| TPSA | 52.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.45 |
| LogP ≤ 5 | 8.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|