C16H18N2O8S — CID 142488329
2-(2-aminophenyl)sulfanyl-5-methoxy-N,N-bis(trihydroxymethyl)benzamide (PubChem CID 142488329) has the molecular formula C16H18N2O8S and a molecular weight of 398.39 g/mol. Its IUPAC name is 2-(2-aminophenyl)sulfanyl-5-methoxy-N,N-bis(trihydroxymethyl)benzamide.
| Compound Name | 2-(2-aminophenyl)sulfanyl-5-methoxy-N,N-bis(trihydroxymethyl)benzamide |
|---|---|
| PubChem CID | 142488329 |
| Molecular Formula | C16H18N2O8S |
| Molecular Weight | 398.39 g/mol |
| Exact Mass | 398.08 |
| IUPAC Name | 2-(2-aminophenyl)sulfanyl-5-methoxy-N,N-bis(trihydroxymethyl)benzamide |
| SMILES | COc1ccc(Sc2ccccc2N)c(C(=O)N(C(O)(O)O)C(O)(O)O)c1 |
| InChI | InChI=1S/C16H18N2O8S/c1-26-9-6-7-12(27-13-5-3-2-4-11(13)17)10(8-9)14(19)18(15(20,21)22)16(23,24)25/h2-8,20-25H,17H2,1H3 |
| InChIKey | RACFRQKPBTWZOA-UHFFFAOYSA-N |
| XLogP | -0.95 |
| TPSA | 176.94 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.39 |
| LogP ≤ 5 | -0.95 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|