C19H30N2O10 — CID 142489210
[(2R,3R,4R,5R,6S)-5-acetamido-3,4-diacetyloxy-6-(1-amino-1-oxopentan-2-yl)oxyoxan-2-yl]methyl acetate (PubChem CID 142489210) has the molecular formula C19H30N2O10 and a molecular weight of 446.45 g/mol. Its IUPAC name is [(2R,3R,4R,5R,6S)-5-acetamido-3,4-diacetyloxy-6-(1-amino-1-oxopentan-2-yl)oxyoxan-2-yl]methyl acetate.
| Compound Name | [(2R,3R,4R,5R,6S)-5-acetamido-3,4-diacetyloxy-6-(1-amino-1-oxopentan-2-yl)oxyoxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 142489210 |
| Molecular Formula | C19H30N2O10 |
| Molecular Weight | 446.45 g/mol |
| Exact Mass | 446.19 |
| IUPAC Name | [(2R,3R,4R,5R,6S)-5-acetamido-3,4-diacetyloxy-6-(1-amino-1-oxopentan-2-yl)oxyoxan-2-yl]methyl acetate |
| SMILES | CCCC(O[C@@H]1O[C@H](COC(C)=O)[C@H](OC(C)=O)[C@H](OC(C)=O)[C@H]1NC(C)=O)C(N)=O |
| InChI | InChI=1S/C19H30N2O10/c1-6-7-13(18(20)26)30-19-15(21-9(2)22)17(29-12(5)25)16(28-11(4)24)14(31-19)8-27-10(3)23/h13-17,19H,6-8H2,1-5H3,(H2,20,26)(H,21,22)/t13?,14-,15-,16+,17-,19-/m1/s1 |
| InChIKey | JTOYCEBXYKLCGU-ZRAUNAMOSA-N |
| XLogP | -0.69 |
| TPSA | 169.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.45 |
| LogP ≤ 5 | -0.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|