C50H32N2O — CID 142490992
2-[3-[4-(6,10b-dihydropyren-1-yl)phenyl]dibenzofuran-4-yl]-4,6-diphenylpyrimidine (PubChem CID 142490992) has the molecular formula C50H32N2O and a molecular weight of 676.82 g/mol. Its IUPAC name is 2-[3-[4-(6,10b-dihydropyren-1-yl)phenyl]dibenzofuran-4-yl]-4,6-diphenylpyrimidine.
| Compound Name | 2-[3-[4-(6,10b-dihydropyren-1-yl)phenyl]dibenzofuran-4-yl]-4,6-diphenylpyrimidine |
|---|---|
| PubChem CID | 142490992 |
| Molecular Formula | C50H32N2O |
| Molecular Weight | 676.82 g/mol |
| Exact Mass | 676.25 |
| IUPAC Name | 2-[3-[4-(6,10b-dihydropyren-1-yl)phenyl]dibenzofuran-4-yl]-4,6-diphenylpyrimidine |
| SMILES | C1=CC2=C3C(=CC=C4C=CC(c5ccc(-c6ccc7c(oc8ccccc87)c6-c6nc(-c7ccccc7)cc(-c7ccccc7)n6)cc5)=C(C=C2)C43)C1 |
| InChI | InChI=1S/C50H32N2O/c1-3-10-33(11-4-1)43-30-44(34-12-5-2-6-13-34)52-50(51-43)48-39(28-29-42-40-16-7-8-17-45(40)53-49(42)48)32-20-18-31(19-21-32)38-26-24-37-23-22-35-14-9-15-36-25-27-41(38)47(37)46(35)36/h1-13,15-30,47H,14H2 |
| InChIKey | BVFBWXLJMJAKFZ-UHFFFAOYSA-N |
| XLogP | 12.68 |
| TPSA | 38.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 676.82 |
| LogP ≤ 5 | 12.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |