About S-phenylselanyl pentanethioate
S-phenylselanyl pentanethioate (PubChem CID 14249104) has the molecular formula C11H14OSSe
and a molecular weight of 273.26 g/mol. Its IUPAC name is S-phenylselanyl pentanethioate.
Molecular Properties
| Compound Name | S-phenylselanyl pentanethioate |
| PubChem CID | 14249104 |
| Molecular Formula | C11H14OSSe |
| Molecular Weight | 273.26 g/mol |
| Exact Mass | 273.99 |
| IUPAC Name | S-phenylselanyl pentanethioate |
| SMILES | CCCCC(=O)S[Se]c1ccccc1 |
| InChI | InChI=1S/C11H14OSSe/c1-2-3-9-11(12)13-14-10-7-5-4-6-8-10/h4-8H,2-3,9H2,1H3 |
| InChIKey | FSPJCECODFPKMA-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 273.26 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze S-phenylselanyl pentanethioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of S-phenylselanyl pentanethioate?
The IUPAC name of S-phenylselanyl pentanethioate (CID 14249104) is S-phenylselanyl pentanethioate.
What is the SMILES notation for S-phenylselanyl pentanethioate?
The canonical SMILES for S-phenylselanyl pentanethioate is CCCCC(=O)S[Se]c1ccccc1.
What is the InChIKey of S-phenylselanyl pentanethioate?
The InChIKey is FSPJCECODFPKMA-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14OSSe/c1-2-3-9-11(12)13-14-10-7-5-4-6-8-10/h4-8H,2-3,9H2,1H3.
What are the key properties of S-phenylselanyl pentanethioate?
S-phenylselanyl pentanethioate has a molecular weight of 273.26 g/mol, XLogP of 2.38, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for S-phenylselanyl pentanethioate is sourced from PubChem (CID 14249104), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).