C14H31N3 — CID 142492050
N,2,2,4,4-pentamethyl-5-piperazin-1-ylpentan-1-amine (PubChem CID 142492050) has the molecular formula C14H31N3 and a molecular weight of 241.42 g/mol. Its IUPAC name is N,2,2,4,4-pentamethyl-5-piperazin-1-ylpentan-1-amine.
| Compound Name | N,2,2,4,4-pentamethyl-5-piperazin-1-ylpentan-1-amine |
|---|---|
| PubChem CID | 142492050 |
| Molecular Formula | C14H31N3 |
| Molecular Weight | 241.42 g/mol |
| Exact Mass | 241.25 |
| IUPAC Name | N,2,2,4,4-pentamethyl-5-piperazin-1-ylpentan-1-amine |
| SMILES | CNCC(C)(C)CC(C)(C)CN1CCNCC1 |
| InChI | InChI=1S/C14H31N3/c1-13(2,11-15-5)10-14(3,4)12-17-8-6-16-7-9-17/h15-16H,6-12H2,1-5H3 |
| InChIKey | ZETJWCFAYHYLCP-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 27.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.42 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |