C46H40N4O9 — CID 142492685
[(3S,4R,5R)-3,4,5-tris[[2-(1H-indol-3-yl)acetyl]oxy]oxan-2-yl]methyl 2-(1H-indol-3-yl)acetate (PubChem CID 142492685) has the molecular formula C46H40N4O9 and a molecular weight of 792.85 g/mol. Its IUPAC name is [(3S,4R,5R)-3,4,5-tris[[2-(1H-indol-3-yl)acetyl]oxy]oxan-2-yl]methyl 2-(1H-indol-3-yl)acetate.
| Compound Name | [(3S,4R,5R)-3,4,5-tris[[2-(1H-indol-3-yl)acetyl]oxy]oxan-2-yl]methyl 2-(1H-indol-3-yl)acetate |
|---|---|
| PubChem CID | 142492685 |
| Molecular Formula | C46H40N4O9 |
| Molecular Weight | 792.85 g/mol |
| Exact Mass | 792.28 |
| IUPAC Name | [(3S,4R,5R)-3,4,5-tris[[2-(1H-indol-3-yl)acetyl]oxy]oxan-2-yl]methyl 2-(1H-indol-3-yl)acetate |
| SMILES | O=C(Cc1c[nH]c2ccccc12)OCC1OC[C@@H](OC(=O)Cc2c[nH]c3ccccc23)[C@@H](OC(=O)Cc2c[nH]c3ccccc23)[C@H]1OC(=O)Cc1c[nH]c2ccccc12 |
| InChI | InChI=1S/C46H40N4O9/c51-41(17-27-21-47-35-13-5-1-9-31(27)35)56-25-39-45(58-43(53)19-29-23-49-37-15-7-3-11-33(29)37)46(59-44(54)20-30-24-50-38-16-8-4-12-34(30)38)40(26-55-39)57-42(52)18-28-22-48-36-14-6-2-10-32(28)36/h1-16,21-24,39-40,45-50H,17-20,25-26H2/t39?,40-,45+,46-/m1/s1 |
| InChIKey | GOORSMZCMZPZJH-HTOLQSCJSA-N |
| XLogP | 6.56 |
| TPSA | 177.59 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 59 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 792.85 |
| LogP ≤ 5 | 6.56 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|