About 5-ethyl-1H-pyridin-2-one;molecular hydrogen
5-ethyl-1H-pyridin-2-one;molecular hydrogen (PubChem CID 142493028) has the molecular formula C7H11NO
and a molecular weight of 125.17 g/mol. Its IUPAC name is 5-ethyl-1H-pyridin-2-one;molecular hydrogen.
Molecular Properties
| Compound Name | 5-ethyl-1H-pyridin-2-one;molecular hydrogen |
| PubChem CID | 142493028 |
| Molecular Formula | C7H11NO |
| Molecular Weight | 125.17 g/mol |
| Exact Mass | 125.08 |
| IUPAC Name | 5-ethyl-1H-pyridin-2-one;molecular hydrogen |
| SMILES | CCc1ccc(=O)[nH]c1.[H][H] |
| InChI | InChI=1S/C7H9NO.H2/c1-2-6-3-4-7(9)8-5-6;/h3-5H,2H2,1H3,(H,8,9);1H |
| InChIKey | WWZCUXUGOQOPAN-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 32.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 125.17 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 5-ethyl-1H-pyridin-2-one;molecular hydrogen with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-ethyl-1H-pyridin-2-one;molecular hydrogen?
The IUPAC name of 5-ethyl-1H-pyridin-2-one;molecular hydrogen (CID 142493028) is 5-ethyl-1H-pyridin-2-one;molecular hydrogen.
What is the SMILES notation for 5-ethyl-1H-pyridin-2-one;molecular hydrogen?
The canonical SMILES for 5-ethyl-1H-pyridin-2-one;molecular hydrogen is CCc1ccc(=O)[nH]c1.[H][H].
What is the InChIKey of 5-ethyl-1H-pyridin-2-one;molecular hydrogen?
The InChIKey is WWZCUXUGOQOPAN-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H9NO.H2/c1-2-6-3-4-7(9)8-5-6;/h3-5H,2H2,1H3,(H,8,9);1H.
What are the key properties of 5-ethyl-1H-pyridin-2-one;molecular hydrogen?
5-ethyl-1H-pyridin-2-one;molecular hydrogen has a molecular weight of 125.17 g/mol, XLogP of 1.18, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5-ethyl-1H-pyridin-2-one;molecular hydrogen is sourced from PubChem (CID 142493028), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).