C12H19N3 — CID 142493070
ethane;4-methyl-2-(4-methylphenyl)-3H-1,2,4-triazole (PubChem CID 142493070) has the molecular formula C12H19N3 and a molecular weight of 205.30 g/mol. Its IUPAC name is ethane;4-methyl-2-(4-methylphenyl)-3H-1,2,4-triazole.
| Compound Name | ethane;4-methyl-2-(4-methylphenyl)-3H-1,2,4-triazole |
|---|---|
| PubChem CID | 142493070 |
| Molecular Formula | C12H19N3 |
| Molecular Weight | 205.30 g/mol |
| Exact Mass | 205.16 |
| IUPAC Name | ethane;4-methyl-2-(4-methylphenyl)-3H-1,2,4-triazole |
| SMILES | CC.Cc1ccc(N2CN(C)C=N2)cc1 |
| InChI | InChI=1S/C10H13N3.C2H6/c1-9-3-5-10(6-4-9)13-8-12(2)7-11-13;1-2/h3-7H,8H2,1-2H3;1-2H3 |
| InChIKey | WUYMUCNHEYEBMX-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 18.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.30 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |