C23H29N7O2 — CID 142493349
5-[4-(2-aminoethyl)phenyl]-3-methylpyrazin-2-amine;N-(4-morpholin-4-yl-3-pyridinyl)formamide (PubChem CID 142493349) has the molecular formula C23H29N7O2 and a molecular weight of 435.53 g/mol. Its IUPAC name is 5-[4-(2-aminoethyl)phenyl]-3-methylpyrazin-2-amine;N-(4-morpholin-4-yl-3-pyridinyl)formamide.
| Compound Name | 5-[4-(2-aminoethyl)phenyl]-3-methylpyrazin-2-amine;N-(4-morpholin-4-yl-3-pyridinyl)formamide |
|---|---|
| PubChem CID | 142493349 |
| Molecular Formula | C23H29N7O2 |
| Molecular Weight | 435.53 g/mol |
| Exact Mass | 435.24 |
| IUPAC Name | 5-[4-(2-aminoethyl)phenyl]-3-methylpyrazin-2-amine;N-(4-morpholin-4-yl-3-pyridinyl)formamide |
| SMILES | Cc1nc(-c2ccc(CCN)cc2)cnc1N.O=CNc1cnccc1N1CCOCC1 |
| InChI | InChI=1S/C13H16N4.C10H13N3O2/c1-9-13(15)16-8-12(17-9)11-4-2-10(3-5-11)6-7-14;14-8-12-9-7-11-2-1-10(9)13-3-5-15-6-4-13/h2-5,8H,6-7,14H2,1H3,(H2,15,16);1-2,7-8H,3-6H2,(H,12,14) |
| InChIKey | AXGOKOVQTKREPV-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 132.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.53 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|