C23H26BN7O2 — CID 174022831
CID 174022831 (PubChem CID 174022831) has the molecular formula C23H26BN7O2 and a molecular weight of 443.32 g/mol.
| Compound Name | CID 174022831 |
|---|---|
| PubChem CID | 174022831 |
| Molecular Formula | C23H26BN7O2 |
| Molecular Weight | 443.32 g/mol |
| Exact Mass | 443.22 |
| IUPAC Name | — |
| SMILES | [B]NCCCc1ccc(-c2cnc(N)c(C(=O)Nc3cnccc3N3CCOCC3)n2)cc1 |
| InChI | InChI=1S/C23H26BN7O2/c24-28-8-1-2-16-3-5-17(6-4-16)18-15-27-22(25)21(29-18)23(32)30-19-14-26-9-7-20(19)31-10-12-33-13-11-31/h3-7,9,14-15,28H,1-2,8,10-13H2,(H2,25,27)(H,30,32) |
| InChIKey | FCPSHSONBYZCPN-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 118.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.32 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|