C24H27BN8O2 — CID 174022880
CID 174022880 (PubChem CID 174022880) has the molecular formula C24H27BN8O2 and a molecular weight of 470.35 g/mol.
| Compound Name | CID 174022880 |
|---|---|
| PubChem CID | 174022880 |
| Molecular Formula | C24H27BN8O2 |
| Molecular Weight | 470.35 g/mol |
| Exact Mass | 470.24 |
| IUPAC Name | — |
| SMILES | [B]N1CC[C@@H](Nc2ccc(-c3cnc(N)c(C(=O)Nc4cnccc4N4CCOCC4)n3)cc2)C1 |
| InChI | InChI=1S/C24H27BN8O2/c25-33-8-6-18(15-33)29-17-3-1-16(2-4-17)19-14-28-23(26)22(30-19)24(34)31-20-13-27-7-5-21(20)32-9-11-35-12-10-32/h1-5,7,13-14,18,29H,6,8-12,15H2,(H2,26,28)(H,31,34)/t18-/m1/s1 |
| InChIKey | XRQSMVPUAGIGGZ-GOSISDBHSA-N |
| XLogP | 1.78 |
| TPSA | 121.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.35 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|