C28H34BN7O4S — CID 174022933
CID 174022933 (PubChem CID 174022933) has the molecular formula C28H34BN7O4S and a molecular weight of 575.50 g/mol.
| Compound Name | CID 174022933 |
|---|---|
| PubChem CID | 174022933 |
| Molecular Formula | C28H34BN7O4S |
| Molecular Weight | 575.50 g/mol |
| Exact Mass | 575.25 |
| IUPAC Name | — |
| SMILES | [B]SC(C)CCC(=O)NCC(C)Oc1ccc(-c2cnc(N)c(C(=O)Nc3cnccc3N3CCOCC3)n2)cc1 |
| InChI | InChI=1S/C28H34BN7O4S/c1-18(15-32-25(37)8-3-19(2)41-29)40-21-6-4-20(5-7-21)22-17-33-27(30)26(34-22)28(38)35-23-16-31-10-9-24(23)36-11-13-39-14-12-36/h4-7,9-10,16-19H,3,8,11-15H2,1-2H3,(H2,30,33)(H,32,37)(H,35,38) |
| InChIKey | RPNNVOHGAYXOGZ-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 144.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.50 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|